N,N,N’,N’-Tetramethyl-1,4-phenylenediamine CAS 100-22-1
| Name | N,N,N’,N’-Tetramethyl-p-phenylenediamine | 
| Synonyms | N,N,N,N-tetramethyl-P-*phenylenediamine free ba 1,4-Bis(dimethylamino)benzene~Wursters Blue N,N,N’,N’-tetramethylbenzene-1,4-diamine | 
| CAS | 100-22-1 | 
| EINECS | 202-831-6 | 
| InChI | InChI=1/C10H16N2/c1-11(2)9-5-7-10(8-6-9)12(3)4/h5-8H,1-4H3 | 
| Molecular Formula | C10H16N2 | 
| Molar Mass | 164.247 g/mol | 
| Density | 0.992g/cm3 | 
| Melting Point | 48-52℃ | 
| Boling Point | 260.6°C at 760 mmHg | 
| Flash Point | 104.9°C | 
| Solubility | slightly in cold, more in hot water | 
| Vapor Presure | 0.0121mmHg at 25°C | 
| Refractive Index | 1.577 | 
ChemicalCAS.com offers price quotation and technology support of chemical from China. In the quotation from China factory supplier, we will include price terms, payment, lead time, COA, TDS, MSDS etc. We make sure the reliable purchase source and product quality. If you need to buy chemical from China, please feel free to contact sales@chemicalcas.com
Write your message here and send it to us
        



 
				







